C8H11NO3 — CID 130977924
(9R,9aR)-9-hydroxy-5,6,9,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azepin-3-one (PubChem CID 130977924) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (9R,9aR)-9-hydroxy-5,6,9,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azepin-3-one.
| Compound Name | (9R,9aR)-9-hydroxy-5,6,9,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azepin-3-one |
|---|---|
| PubChem CID | 130977924 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (9R,9aR)-9-hydroxy-5,6,9,9a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azepin-3-one |
| SMILES | O=C1OC[C@@H]2[C@H](O)C=CCCN12 |
| InChI | InChI=1S/C8H11NO3/c10-7-3-1-2-4-9-6(7)5-12-8(9)11/h1,3,6-7,10H,2,4-5H2/t6-,7-/m1/s1 |
| InChIKey | ATWMSTNOHHSQRP-RNFRBKRXSA-N |
| XLogP | 0.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|