C18H21NO6 — CID 15459616
[(6aS,7R,8S,10aS,10bR)-7,8-dihydroxy-3-oxo-5,6,7,8,9,10,10a,10b-octahydro-1H-[1,3]oxazolo[4,3-a]isoquinolin-6a-yl] benzoate (PubChem CID 15459616) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is [(6aS,7R,8S,10aS,10bR)-7,8-dihydroxy-3-oxo-5,6,7,8,9,10,10a,10b-octahydro-1H-[1,3]oxazolo[4,3-a]isoquinolin-6a-yl] benzoate.
| Compound Name | [(6aS,7R,8S,10aS,10bR)-7,8-dihydroxy-3-oxo-5,6,7,8,9,10,10a,10b-octahydro-1H-[1,3]oxazolo[4,3-a]isoquinolin-6a-yl] benzoate |
|---|---|
| PubChem CID | 15459616 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [(6aS,7R,8S,10aS,10bR)-7,8-dihydroxy-3-oxo-5,6,7,8,9,10,10a,10b-octahydro-1H-[1,3]oxazolo[4,3-a]isoquinolin-6a-yl] benzoate |
| SMILES | O=C(O[C@@]12CCN3C(=O)OC[C@H]3[C@@H]1CC[C@H](O)[C@H]2O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO6/c20-14-7-6-12-13-10-24-17(23)19(13)9-8-18(12,15(14)21)25-16(22)11-4-2-1-3-5-11/h1-5,12-15,20-21H,6-10H2/t12-,13-,14-,15+,18-/m0/s1 |
| InChIKey | OFCQEOOPTWIESF-IBTNMTNLSA-N |
| XLogP | 0.94 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |