About 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate
2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate (PubChem CID 85397832) has the molecular formula C17H14O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate.
Molecular Properties
| Compound Name | 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate |
| PubChem CID | 85397832 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate |
| SMILES | O=C(OC12OC1CCc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C17H14O3/c18-16(13-7-2-1-3-8-13)20-17-14-9-5-4-6-12(14)10-11-15(17)19-17/h1-9,15H,10-11H2 |
| InChIKey | INRCFPFRZFPMFV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate?
The IUPAC name of 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate (CID 85397832) is 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate.
What is the SMILES notation for 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate?
The canonical SMILES for 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate is O=C(OC12OC1CCc1ccccc12)c1ccccc1.
What is the InChIKey of 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate?
The InChIKey is INRCFPFRZFPMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3/c18-16(13-7-2-1-3-8-13)20-17-14-9-5-4-6-12(14)10-11-15(17)19-17/h1-9,15H,10-11H2.
What are the key properties of 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate?
2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate has a molecular weight of 266.30 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1aH-naphtho[1,2-b]oxiren-7b-yl benzoate is sourced from PubChem (CID 85397832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).