C15H18N2O2 — CID 170423038
11-benzyl-4-oxa-6,11-diazatricyclo[6.2.1.02,6]undecan-5-one (PubChem CID 170423038) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 11-benzyl-4-oxa-6,11-diazatricyclo[6.2.1.02,6]undecan-5-one.
| Compound Name | 11-benzyl-4-oxa-6,11-diazatricyclo[6.2.1.02,6]undecan-5-one |
|---|---|
| PubChem CID | 170423038 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 11-benzyl-4-oxa-6,11-diazatricyclo[6.2.1.02,6]undecan-5-one |
| SMILES | O=C1OCC2C3CCC(CN12)N3Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2/c18-15-17-9-12-6-7-13(14(17)10-19-15)16(12)8-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2 |
| InChIKey | ZVQZUSKADJNBIO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |