C12H13F3N2O3 — CID 11380715
(1S)-2,2,2-trifluoro-1-[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]ethanol (PubChem CID 11380715) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]ethanol.
| Compound Name | (1S)-2,2,2-trifluoro-1-[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 11380715 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(N2CCC[C@H]2[C@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)11(18)10-2-1-7-16(10)8-3-5-9(6-4-8)17(19)20/h3-6,10-11,18H,1-2,7H2/t10-,11-/m0/s1 |
| InChIKey | JJFUIIQUKRRFAS-QWRGUYRKSA-N |
| XLogP | 2.49 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|