C17H28O4 — CID 11380927
methyl (2R)-2-[(1S,2E,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate (PubChem CID 11380927) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is methyl (2R)-2-[(1S,2E,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate.
| Compound Name | methyl (2R)-2-[(1S,2E,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 11380927 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | methyl (2R)-2-[(1S,2E,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate |
| SMILES | CO/C=C1\[C@@H](CCC(C)=O)[C@H](C)CC[C@H]1[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C17H28O4/c1-11-6-8-15(13(3)17(19)21-5)16(10-20-4)14(11)9-7-12(2)18/h10-11,13-15H,6-9H2,1-5H3/b16-10+/t11-,13-,14+,15+/m1/s1 |
| InChIKey | XTXYRIUIWCQLCP-TWBQYWSTSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|