C18H27O5+ — CID 134949246
ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoate (PubChem CID 134949246) has the molecular formula C18H27O5+ and a molecular weight of 323.41 g/mol. Its IUPAC name is ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoate.
| Compound Name | ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoate |
|---|---|
| PubChem CID | 134949246 |
| Molecular Formula | C18H27O5+ |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-2-ium-9-yl]propanoate |
| SMILES | CCOC(=O)OC(=O)[C@H](C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)=[O+]C=C21 |
| InChI | InChI=1S/C18H27O5/c1-5-21-18(20)23-17(19)13(4)15-8-6-11(2)14-9-7-12(3)22-10-16(14)15/h10-11,13-15H,5-9H2,1-4H3/q+1/t11-,13-,14+,15+/m1/s1 |
| InChIKey | YXVKOWTVJKHLHT-RZFFKMDDSA-N |
| XLogP | 3.79 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|