C18H28O6 — CID 134949247
ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-9-yl]propanoate (PubChem CID 134949247) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-9-yl]propanoate.
| Compound Name | ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-9-yl]propanoate |
|---|---|
| PubChem CID | 134949247 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethoxycarbonyl (2R)-2-[(5aS,6R,9S)-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-2-benzoxepin-9-yl]propanoate |
| SMILES | CCOC(=O)OC(=O)[C@H](C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)(O)OC=C21 |
| InChI | InChI=1S/C18H28O6/c1-5-22-17(20)24-16(19)12(3)14-7-6-11(2)13-8-9-18(4,21)23-10-15(13)14/h10-14,21H,5-9H2,1-4H3/t11-,12-,13+,14+,18?/m1/s1 |
| InChIKey | OCADMPYIHCQKPP-MZCNEJIUSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|