C18H28O6 — CID 134949248
ethoxycarbonyl (2R)-2-[(1S,2E,3S,4R)-2-(hydroxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate (PubChem CID 134949248) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethoxycarbonyl (2R)-2-[(1S,2E,3S,4R)-2-(hydroxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate.
| Compound Name | ethoxycarbonyl (2R)-2-[(1S,2E,3S,4R)-2-(hydroxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 134949248 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethoxycarbonyl (2R)-2-[(1S,2E,3S,4R)-2-(hydroxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoate |
| SMILES | CCOC(=O)OC(=O)[C@H](C)[C@@H]1CC[C@@H](C)[C@H](CCC(C)=O)/C1=C\O |
| InChI | InChI=1S/C18H28O6/c1-5-23-18(22)24-17(21)13(4)15-8-6-11(2)14(16(15)10-19)9-7-12(3)20/h10-11,13-15,19H,5-9H2,1-4H3/b16-10+/t11-,13-,14+,15+/m1/s1 |
| InChIKey | MVFAOCKVGAANLD-TWBQYWSTSA-N |
| XLogP | 3.80 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|