C16H26O4 — CID 146169021
(2R)-2-[(1S,2Z,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoic acid (PubChem CID 146169021) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2R)-2-[(1S,2Z,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoic acid.
| Compound Name | (2R)-2-[(1S,2Z,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 146169021 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (2R)-2-[(1S,2Z,3S,4R)-2-(methoxymethylidene)-4-methyl-3-(3-oxobutyl)cyclohexyl]propanoic acid |
| SMILES | CO/C=C1/[C@@H](CCC(C)=O)[C@H](C)CC[C@H]1[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H26O4/c1-10-5-7-14(12(3)16(18)19)15(9-20-4)13(10)8-6-11(2)17/h9-10,12-14H,5-8H2,1-4H3,(H,18,19)/b15-9-/t10-,12-,13+,14+/m1/s1 |
| InChIKey | ACZBHKANQUVYBQ-PQQAFDMISA-N |
| XLogP | 3.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|