C12H16ClFN4O2 — CID 11381118
1-(2-aminobutanoylamino)-3-[(2-chloro-6-fluorophenyl)methyl]urea (PubChem CID 11381118) has the molecular formula C12H16ClFN4O2 and a molecular weight of 302.74 g/mol. Its IUPAC name is 1-(2-aminobutanoylamino)-3-[(2-chloro-6-fluorophenyl)methyl]urea.
| Compound Name | 1-(2-aminobutanoylamino)-3-[(2-chloro-6-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 11381118 |
| Molecular Formula | C12H16ClFN4O2 |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(2-aminobutanoylamino)-3-[(2-chloro-6-fluorophenyl)methyl]urea |
| SMILES | CCC(N)C(=O)NNC(=O)NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H16ClFN4O2/c1-2-10(15)11(19)17-18-12(20)16-6-7-8(13)4-3-5-9(7)14/h3-5,10H,2,6,15H2,1H3,(H,17,19)(H2,16,18,20) |
| InChIKey | ZMTYFEPKFZVZIU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|