C16H12FN3OS2 — CID 11382379
N-(4-fluorophenyl)-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)benzamide (PubChem CID 11382379) has the molecular formula C16H12FN3OS2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)benzamide.
| Compound Name | N-(4-fluorophenyl)-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 11382379 |
| Molecular Formula | C16H12FN3OS2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(4-fluorophenyl)-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(CSc2nncs2)cc1 |
| InChI | InChI=1S/C16H12FN3OS2/c17-13-5-7-14(8-6-13)19-15(21)12-3-1-11(2-4-12)9-22-16-20-18-10-23-16/h1-8,10H,9H2,(H,19,21) |
| InChIKey | DXPMHTQKYPBRIX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |