C22H22O2S — CID 11382529
(3aS,6S)-7-methyl-5-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran (PubChem CID 11382529) has the molecular formula C22H22O2S and a molecular weight of 350.48 g/mol. Its IUPAC name is (3aS,6S)-7-methyl-5-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran.
| Compound Name | (3aS,6S)-7-methyl-5-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 11382529 |
| Molecular Formula | C22H22O2S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (3aS,6S)-7-methyl-5-[(S)-(4-methylphenyl)sulfinyl]-6-phenyl-1,3,3a,6-tetrahydro-2-benzofuran |
| SMILES | CC1=C2COC[C@H]2C=C([S@@](=O)c2ccc(C)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H22O2S/c1-15-8-10-19(11-9-15)25(23)21-12-18-13-24-14-20(18)16(2)22(21)17-6-4-3-5-7-17/h3-12,18,22H,13-14H2,1-2H3/t18-,22-,25+/m1/s1 |
| InChIKey | CJGPOXUEPYEAFP-KPCPBYSCSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|