C22H20O2S — CID 139038697
(2S,3S)-2-methyl-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-phenyloxirane (PubChem CID 139038697) has the molecular formula C22H20O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-phenyloxirane.
| Compound Name | (2S,3S)-2-methyl-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-phenyloxirane |
|---|---|
| PubChem CID | 139038697 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (2S,3S)-2-methyl-3-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-phenyloxirane |
| SMILES | Cc1ccc([S@](=O)c2ccccc2[C@@H]2O[C@@]2(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O2S/c1-16-12-14-18(15-13-16)25(23)20-11-7-6-10-19(20)21-22(2,24-21)17-8-4-3-5-9-17/h3-15,21H,1-2H3/t21-,22-,25-/m0/s1 |
| InChIKey | CLFYEOZGQWIMBG-HWBMXIPRSA-N |
| XLogP | 5.15 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|