C19H26O2S — CID 45142058
(3aS,5R,7aS)-5-butyl-6-[(R)-(4-methylphenyl)sulfinyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran (PubChem CID 45142058) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-butyl-6-[(R)-(4-methylphenyl)sulfinyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran.
| Compound Name | (3aS,5R,7aS)-5-butyl-6-[(R)-(4-methylphenyl)sulfinyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran |
|---|---|
| PubChem CID | 45142058 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (3aS,5R,7aS)-5-butyl-6-[(R)-(4-methylphenyl)sulfinyl]-1,3,3a,4,5,7a-hexahydro-2-benzofuran |
| SMILES | CCCC[C@@H]1C[C@@H]2COC[C@@H]2C=C1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26O2S/c1-3-4-5-15-10-16-12-21-13-17(16)11-19(15)22(20)18-8-6-14(2)7-9-18/h6-9,11,15-17H,3-5,10,12-13H2,1-2H3/t15-,16-,17+,22+/m1/s1 |
| InChIKey | QGDADNHIQGLBAM-FSNCLGKMSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |