C18H27O5P — CID 11382656
4-diethoxyphosphoryl-2-(2-methylpropoxy)-5-phenyl-2,3-dihydrofuran (PubChem CID 11382656) has the molecular formula C18H27O5P and a molecular weight of 354.38 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-2-(2-methylpropoxy)-5-phenyl-2,3-dihydrofuran.
| Compound Name | 4-diethoxyphosphoryl-2-(2-methylpropoxy)-5-phenyl-2,3-dihydrofuran |
|---|---|
| PubChem CID | 11382656 |
| Molecular Formula | C18H27O5P |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-diethoxyphosphoryl-2-(2-methylpropoxy)-5-phenyl-2,3-dihydrofuran |
| SMILES | CCOP(=O)(OCC)C1=C(c2ccccc2)OC(OCC(C)C)C1 |
| InChI | InChI=1S/C18H27O5P/c1-5-21-24(19,22-6-2)16-12-17(20-13-14(3)4)23-18(16)15-10-8-7-9-11-15/h7-11,14,17H,5-6,12-13H2,1-4H3 |
| InChIKey | CTNAMOKBZXKPEP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|