C24H23NO6 — CID 10938724
ethyl (6R,7aR)-6-ethoxy-2,3-dioxo-1,4-diphenyl-6,7-dihydropyrano[4,3-b]pyrrole-7a-carboxylate (PubChem CID 10938724) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is ethyl (6R,7aR)-6-ethoxy-2,3-dioxo-1,4-diphenyl-6,7-dihydropyrano[4,3-b]pyrrole-7a-carboxylate.
| Compound Name | ethyl (6R,7aR)-6-ethoxy-2,3-dioxo-1,4-diphenyl-6,7-dihydropyrano[4,3-b]pyrrole-7a-carboxylate |
|---|---|
| PubChem CID | 10938724 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | ethyl (6R,7aR)-6-ethoxy-2,3-dioxo-1,4-diphenyl-6,7-dihydropyrano[4,3-b]pyrrole-7a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H](OCC)OC(c3ccccc3)=C1C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C24H23NO6/c1-3-29-18-15-24(23(28)30-4-2)19(21(31-18)16-11-7-5-8-12-16)20(26)22(27)25(24)17-13-9-6-10-14-17/h5-14,18H,3-4,15H2,1-2H3/t18-,24-/m1/s1 |
| InChIKey | LXGOCPSOOMIZET-HOYKHHGWSA-N |
| XLogP | 3.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|