C25H23NO6 — CID 6576981
ethyl (1R,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.4.0.02,6]tridec-6-ene-2-carboxylate (PubChem CID 6576981) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is ethyl (1R,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.4.0.02,6]tridec-6-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.4.0.02,6]tridec-6-ene-2-carboxylate |
|---|---|
| PubChem CID | 6576981 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | ethyl (1R,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.4.0.02,6]tridec-6-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=C(c3ccccc3)O[C@H]3OCCC[C@@H]31)C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C25H23NO6/c1-2-30-24(29)25-18-14-9-15-31-23(18)32-21(16-10-5-3-6-11-16)19(25)20(27)22(28)26(25)17-12-7-4-8-13-17/h3-8,10-13,18,23H,2,9,14-15H2,1H3/t18-,23+,25+/m0/s1 |
| InChIKey | SQDQHAHNHIOMCY-XYURVEJXSA-N |
| XLogP | 3.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|