C27H20N2O5 — CID 71696740
ethyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate (PubChem CID 71696740) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate.
| Compound Name | ethyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate |
|---|---|
| PubChem CID | 71696740 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | ethyl 7-benzoyl-2,4-dioxo-3,6-diphenyl-1,3-diazabicyclo[3.2.0]hept-6-ene-5-carboxylate |
| SMILES | CCOC(=O)C12C(=O)N(c3ccccc3)C(=O)N1C(C(=O)c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C27H20N2O5/c1-2-34-25(32)27-21(18-12-6-3-7-13-18)22(23(30)19-14-8-4-9-15-19)29(27)26(33)28(24(27)31)20-16-10-5-11-17-20/h3-17H,2H2,1H3 |
| InChIKey | CTXUGQBRMYMDHY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|