C24H21NO6 — CID 10812012
ethyl (1S,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.3.0.02,6]dodec-6-ene-2-carboxylate (PubChem CID 10812012) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is ethyl (1S,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.3.0.02,6]dodec-6-ene-2-carboxylate.
| Compound Name | ethyl (1S,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.3.0.02,6]dodec-6-ene-2-carboxylate |
|---|---|
| PubChem CID | 10812012 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | ethyl (1S,2R,9R)-4,5-dioxo-3,7-diphenyl-8,10-dioxa-3-azatricyclo[7.3.0.02,6]dodec-6-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=C(c3ccccc3)O[C@H]3OCC[C@H]31)C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C24H21NO6/c1-2-29-23(28)24-17-13-14-30-22(17)31-20(15-9-5-3-6-10-15)18(24)19(26)21(27)25(24)16-11-7-4-8-12-16/h3-12,17,22H,2,13-14H2,1H3/t17-,22-,24-/m1/s1 |
| InChIKey | NCKRCHABFMUZQA-CUHUQNRHSA-N |
| XLogP | 2.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|