C27H23NO5 — CID 98336235
ethyl (1R,2S,3R,10S,11R)-5,6-dioxo-4,8-diphenyl-9-oxa-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-7,12-diene-3-carboxylate (PubChem CID 98336235) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is ethyl (1R,2S,3R,10S,11R)-5,6-dioxo-4,8-diphenyl-9-oxa-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-7,12-diene-3-carboxylate.
| Compound Name | ethyl (1R,2S,3R,10S,11R)-5,6-dioxo-4,8-diphenyl-9-oxa-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-7,12-diene-3-carboxylate |
|---|---|
| PubChem CID | 98336235 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | ethyl (1R,2S,3R,10S,11R)-5,6-dioxo-4,8-diphenyl-9-oxa-4-azatetracyclo[9.2.1.02,10.03,7]tetradeca-7,12-diene-3-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=C(c3ccccc3)O[C@@H]3[C@H]1[C@H]1C=C[C@H]3C1)C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C27H23NO5/c1-2-32-26(31)27-20-17-13-14-18(15-17)24(20)33-23(16-9-5-3-6-10-16)21(27)22(29)25(30)28(27)19-11-7-4-8-12-19/h3-14,17-18,20,24H,2,15H2,1H3/t17-,18-,20+,24-,27+/m0/s1 |
| InChIKey | MZQHFXGRJOXEQH-IEOCRODWSA-N |
| XLogP | 3.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|