C25H37NO3 — CID 11383997
[(1S,4S,5R,7R,10R,11S,18R)-18-hydroxy-11-methyl-19-methylidene-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-en-5-yl] 2-methylbutanoate (PubChem CID 11383997) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is [(1S,4S,5R,7R,10R,11S,18R)-18-hydroxy-11-methyl-19-methylidene-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-en-5-yl] 2-methylbutanoate.
| Compound Name | [(1S,4S,5R,7R,10R,11S,18R)-18-hydroxy-11-methyl-19-methylidene-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-en-5-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 11383997 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | [(1S,4S,5R,7R,10R,11S,18R)-18-hydroxy-11-methyl-19-methylidene-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-en-5-yl] 2-methylbutanoate |
| SMILES | C=C1[C@@H](O)[C@@]23CC[C@@H]4[C@]5(C)CCC[C@@]4(C=NC5)C2C[C@@H]1[C@H](OC(=O)C(C)CC)C3 |
| InChI | InChI=1S/C25H37NO3/c1-5-15(2)22(28)29-18-12-24-10-7-19-23(4)8-6-9-25(19,14-26-13-23)20(24)11-17(18)16(3)21(24)27/h14-15,17-21,27H,3,5-13H2,1-2,4H3/t15?,17-,18+,19+,20?,21+,23+,24+,25-/m0/s1 |
| InChIKey | AQVYWRVHIGOREX-GJLMGJMNSA-N |
| XLogP | 4.56 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|