C19H25NO3 — CID 146166127
(7S,10R)-3-hydroxy-11-methyl-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-ene-5,18-dione (PubChem CID 146166127) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (7S,10R)-3-hydroxy-11-methyl-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-ene-5,18-dione.
| Compound Name | (7S,10R)-3-hydroxy-11-methyl-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-ene-5,18-dione |
|---|---|
| PubChem CID | 146166127 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (7S,10R)-3-hydroxy-11-methyl-13-azapentacyclo[9.3.3.24,7.01,10.02,7]nonadec-13-ene-5,18-dione |
| SMILES | CC12CCCC3(C=NC1)C1C(O)C4CC(=O)[C@@]1(CC[C@H]23)CC4=O |
| InChI | InChI=1S/C19H25NO3/c1-17-4-2-5-19(10-20-9-17)13(17)3-6-18-8-12(21)11(7-14(18)22)15(23)16(18)19/h10-11,13,15-16,23H,2-9H2,1H3/t11?,13-,15?,16?,17?,18-,19?/m1/s1 |
| InChIKey | CZLWJWJPPFSPDH-XFKCJTOGSA-N |
| XLogP | 2.18 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |