C23H22F2N6O3 — CID 11385818
4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methoxy-9-nitro-5H-pyrimido[5,4-b]indole (PubChem CID 11385818) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methoxy-9-nitro-5H-pyrimido[5,4-b]indole.
| Compound Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methoxy-9-nitro-5H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 11385818 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methoxy-9-nitro-5H-pyrimido[5,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(N4CCN(CCc5ccc(F)c(F)c5)CC4)ncnc3c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22F2N6O3/c1-34-18-5-4-17-19(22(18)31(32)33)20-21(28-17)23(27-13-26-20)30-10-8-29(9-11-30)7-6-14-2-3-15(24)16(25)12-14/h2-5,12-13,28H,6-11H2,1H3 |
| InChIKey | FJCDFWMUVBMOQJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|