C22H24N6O5S — CID 11386161
N-(4-methylsulfonylphenyl)-5-nitro-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]oxypyrimidin-4-amine (PubChem CID 11386161) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-nitro-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]oxypyrimidin-4-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-5-nitro-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 11386161 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-nitro-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]oxypyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncnc(OC3CCN(Cc4cccnc4)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N6O5S/c1-34(31,32)19-6-4-17(5-7-19)26-21-20(28(29)30)22(25-15-24-21)33-18-8-11-27(12-9-18)14-16-3-2-10-23-13-16/h2-7,10,13,15,18H,8-9,11-12,14H2,1H3,(H,24,25,26) |
| InChIKey | TUAJGEOZZGFFFZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|