C18H22N2O4S — CID 75367726
(6R)-6-(4-methylsulfonylphenoxy)-4-(pyridin-3-ylmethyl)-1,4-oxazepane (PubChem CID 75367726) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (6R)-6-(4-methylsulfonylphenoxy)-4-(pyridin-3-ylmethyl)-1,4-oxazepane.
| Compound Name | (6R)-6-(4-methylsulfonylphenoxy)-4-(pyridin-3-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 75367726 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (6R)-6-(4-methylsulfonylphenoxy)-4-(pyridin-3-ylmethyl)-1,4-oxazepane |
| SMILES | CS(=O)(=O)c1ccc(O[C@H]2COCCN(Cc3cccnc3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-25(21,22)18-6-4-16(5-7-18)24-17-13-20(9-10-23-14-17)12-15-3-2-8-19-11-15/h2-8,11,17H,9-10,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | DGLFHZCGRSENSB-QGZVFWFLSA-N |
| XLogP | 1.76 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |