C18H20ClNO2 — CID 162808656
4-[(4-chlorophenyl)methyl]-6-phenoxy-1,4-oxazepane (PubChem CID 162808656) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-6-phenoxy-1,4-oxazepane.
| Compound Name | 4-[(4-chlorophenyl)methyl]-6-phenoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 162808656 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-6-phenoxy-1,4-oxazepane |
| SMILES | Clc1ccc(CN2CCOCC(Oc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C18H20ClNO2/c19-16-8-6-15(7-9-16)12-20-10-11-21-14-18(13-20)22-17-4-2-1-3-5-17/h1-9,18H,10-14H2 |
| InChIKey | VVLVBUQJJKACHU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |