C24H52O6Si3 — CID 11386849
(3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)oxan-2-one (PubChem CID 11386849) has the molecular formula C24H52O6Si3 and a molecular weight of 520.93 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 11386849 |
| Molecular Formula | C24H52O6Si3 |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O[C@@H]1CO |
| InChI | InChI=1S/C24H52O6Si3/c1-22(2,3)31(10,11)28-18-17(16-25)27-21(26)20(30-33(14,15)24(7,8)9)19(18)29-32(12,13)23(4,5)6/h17-20,25H,16H2,1-15H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | DCEXZNPXRTZITE-YSTOQKLRSA-N |
| XLogP | 6.08 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|