C30H32F2N6O — CID 11387005
1-benzhydryl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine (PubChem CID 11387005) has the molecular formula C30H32F2N6O and a molecular weight of 530.62 g/mol. Its IUPAC name is 1-benzhydryl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine.
| Compound Name | 1-benzhydryl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 11387005 |
| Molecular Formula | C30H32F2N6O |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 1-benzhydryl-4-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]piperazine |
| SMILES | CC(n1nnc(CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)n1)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C30H32F2N6O/c1-22(30(21-39-30)26-13-12-25(31)20-27(26)32)38-34-28(33-35-38)14-15-36-16-18-37(19-17-36)29(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-13,20,22,29H,14-19,21H2,1H3 |
| InChIKey | NKSOYMYOGCYNPI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|