C36H46O5Si — CID 11387714
(3S,3aR,5R,6R,7S,7aS)-3-ethenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,2-di(propan-2-yl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran (PubChem CID 11387714) has the molecular formula C36H46O5Si and a molecular weight of 586.85 g/mol. Its IUPAC name is (3S,3aR,5R,6R,7S,7aS)-3-ethenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,2-di(propan-2-yl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran.
| Compound Name | (3S,3aR,5R,6R,7S,7aS)-3-ethenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,2-di(propan-2-yl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran |
|---|---|
| PubChem CID | 11387714 |
| Molecular Formula | C36H46O5Si |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | (3S,3aR,5R,6R,7S,7aS)-3-ethenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,2-di(propan-2-yl)-3,3a,5,6,7,7a-hexahydrooxasilolo[4,5-b]pyran |
| SMILES | C=C[C@H]1[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O[Si]1(C(C)C)C(C)C |
| InChI | InChI=1S/C36H46O5Si/c1-6-32-34-36(41-42(32,26(2)3)27(4)5)35(39-24-30-20-14-9-15-21-30)33(38-23-29-18-12-8-13-19-29)31(40-34)25-37-22-28-16-10-7-11-17-28/h6-21,26-27,31-36H,1,22-25H2,2-5H3/t31-,32+,33-,34+,35+,36-/m1/s1 |
| InChIKey | PUNAIRMTATUBEZ-RDLPTSJHSA-N |
| XLogP | 7.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|