C7H10F2O3 — CID 11389742
(1R,3R)-2,2-difluoro-3-(hydroxymethyl)cyclohex-4-ene-1,3-diol (PubChem CID 11389742) has the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. Its IUPAC name is (1R,3R)-2,2-difluoro-3-(hydroxymethyl)cyclohex-4-ene-1,3-diol.
| Compound Name | (1R,3R)-2,2-difluoro-3-(hydroxymethyl)cyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 11389742 |
| Molecular Formula | C7H10F2O3 |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (1R,3R)-2,2-difluoro-3-(hydroxymethyl)cyclohex-4-ene-1,3-diol |
| SMILES | OC[C@]1(O)C=CC[C@@H](O)C1(F)F |
| InChI | InChI=1S/C7H10F2O3/c8-7(9)5(11)2-1-3-6(7,12)4-10/h1,3,5,10-12H,2,4H2/t5-,6-/m1/s1 |
| InChIKey | CVNILJOGSYLNGK-PHDIDXHHSA-N |
| XLogP | -0.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|