C11H14O3 — CID 11389940
(1S,4aR,7R,8aR)-7-hydroxy-8-oxo-2,4a,5,6,7,8a-hexahydro-1H-naphthalene-1-carbaldehyde (PubChem CID 11389940) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1S,4aR,7R,8aR)-7-hydroxy-8-oxo-2,4a,5,6,7,8a-hexahydro-1H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,4aR,7R,8aR)-7-hydroxy-8-oxo-2,4a,5,6,7,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 11389940 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1S,4aR,7R,8aR)-7-hydroxy-8-oxo-2,4a,5,6,7,8a-hexahydro-1H-naphthalene-1-carbaldehyde |
| SMILES | O=C[C@H]1CC=C[C@H]2CC[C@@H](O)C(=O)[C@@H]12 |
| InChI | InChI=1S/C11H14O3/c12-6-8-3-1-2-7-4-5-9(13)11(14)10(7)8/h1-2,6-10,13H,3-5H2/t7-,8+,9+,10+/m0/s1 |
| InChIKey | ONSZTZYAGFSDPL-SGIHWFKDSA-N |
| XLogP | 0.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|