C12H22O3 — CID 11390251
(5S,6S)-6-(methoxymethoxy)deca-1,9-dien-5-ol (PubChem CID 11390251) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (5S,6S)-6-(methoxymethoxy)deca-1,9-dien-5-ol.
| Compound Name | (5S,6S)-6-(methoxymethoxy)deca-1,9-dien-5-ol |
|---|---|
| PubChem CID | 11390251 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (5S,6S)-6-(methoxymethoxy)deca-1,9-dien-5-ol |
| SMILES | C=CCC[C@H](OCOC)[C@@H](O)CCC=C |
| InChI | InChI=1S/C12H22O3/c1-4-6-8-11(13)12(9-7-5-2)15-10-14-3/h4-5,11-13H,1-2,6-10H2,3H3/t11-,12-/m0/s1 |
| InChIKey | WVFCFKFZQHZRRE-RYUDHWBXSA-N |
| XLogP | 2.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|