C10H20O5 — CID 134856154
(2S,3R,4R)-4-(methoxymethoxy)oct-7-ene-1,2,3-triol (PubChem CID 134856154) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is (2S,3R,4R)-4-(methoxymethoxy)oct-7-ene-1,2,3-triol.
| Compound Name | (2S,3R,4R)-4-(methoxymethoxy)oct-7-ene-1,2,3-triol |
|---|---|
| PubChem CID | 134856154 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2S,3R,4R)-4-(methoxymethoxy)oct-7-ene-1,2,3-triol |
| SMILES | C=CCC[C@@H](OCOC)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H20O5/c1-3-4-5-9(15-7-14-2)10(13)8(12)6-11/h3,8-13H,1,4-7H2,2H3/t8-,9+,10+/m0/s1 |
| InChIKey | XEMYSCIOYWIVHZ-IVZWLZJFSA-N |
| XLogP | -0.34 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|