C14H20O3 — CID 11390722
(1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraen-1-ol (PubChem CID 11390722) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraen-1-ol.
| Compound Name | (1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraen-1-ol |
|---|---|
| PubChem CID | 11390722 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,2E,4E,6E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nona-2,4,6,8-tetraen-1-ol |
| SMILES | C=C/C=C/C=C/C=C/[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H20O3/c1-4-5-6-7-8-9-10-12(15)13-11-16-14(2,3)17-13/h4-10,12-13,15H,1,11H2,2-3H3/b6-5+,8-7+,10-9+/t12-,13+/m0/s1 |
| InChIKey | PJRXPASLTKGRBL-NLJBVMSWSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|