C13H11F3O5S — CID 11393534
[(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 11393534) has the molecular formula C13H11F3O5S and a molecular weight of 336.29 g/mol. Its IUPAC name is [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11393534 |
| Molecular Formula | C13H11F3O5S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC[C@@H]1O[C@H]1/C=C/S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O5S/c14-13(15,16)12(17)20-8-11-10(21-11)6-7-22(18,19)9-4-2-1-3-5-9/h1-7,10-11H,8H2/b7-6+/t10-,11-/m0/s1 |
| InChIKey | KDSLSIUEXNFHFZ-JYLGIWJRSA-N |
| XLogP | 1.85 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|