C11H12O4S — CID 11184049
[(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methanol (PubChem CID 11184049) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11184049 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [(2S,3S)-3-[(E)-2-(benzenesulfonyl)ethenyl]oxiran-2-yl]methanol |
| SMILES | O=S(=O)(/C=C/[C@@H]1O[C@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C11H12O4S/c12-8-11-10(15-11)6-7-16(13,14)9-4-2-1-3-5-9/h1-7,10-12H,8H2/b7-6+/t10-,11-/m0/s1 |
| InChIKey | VJABWRDIURZDOS-JYLGIWJRSA-N |
| XLogP | 0.73 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|