C14H16O4S — CID 10826600
(1R)-1-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]prop-2-en-1-ol (PubChem CID 10826600) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is (1R)-1-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 10826600 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (1R)-1-[(2S,3S)-3-ethenyl-2-(4-methylphenyl)sulfonyloxiran-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@@]1(S(=O)(=O)c2ccc(C)cc2)O[C@H]1C=C |
| InChI | InChI=1S/C14H16O4S/c1-4-12(15)14(13(5-2)18-14)19(16,17)11-8-6-10(3)7-9-11/h4-9,12-13,15H,1-2H2,3H3/t12-,13+,14+/m1/s1 |
| InChIKey | VPFGMGYSGJRZKO-RDBSUJKOSA-N |
| XLogP | 1.60 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|