C26H25N3O2 — CID 11395802
2,3-bis(4-methoxyphenyl)-5,5-dimethyl-6H-imidazo[1,2-c]quinazoline (PubChem CID 11395802) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)-5,5-dimethyl-6H-imidazo[1,2-c]quinazoline.
| Compound Name | 2,3-bis(4-methoxyphenyl)-5,5-dimethyl-6H-imidazo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 11395802 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)-5,5-dimethyl-6H-imidazo[1,2-c]quinazoline |
| SMILES | COc1ccc(-c2nc3n(c2-c2ccc(OC)cc2)C(C)(C)Nc2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-26(2)28-22-8-6-5-7-21(22)25-27-23(17-9-13-19(30-3)14-10-17)24(29(25)26)18-11-15-20(31-4)16-12-18/h5-16,28H,1-4H3 |
| InChIKey | OLKCIGOROCCAFK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |