C16H18N4O2 — CID 154341225
2-amino-4-(4-methoxy-N-methylanilino)-1H-quinazolin-2-ol (PubChem CID 154341225) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-amino-4-(4-methoxy-N-methylanilino)-1H-quinazolin-2-ol.
| Compound Name | 2-amino-4-(4-methoxy-N-methylanilino)-1H-quinazolin-2-ol |
|---|---|
| PubChem CID | 154341225 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-amino-4-(4-methoxy-N-methylanilino)-1H-quinazolin-2-ol |
| SMILES | COc1ccc(N(C)C2=NC(N)(O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-20(11-7-9-12(22-2)10-8-11)15-13-5-3-4-6-14(13)18-16(17,21)19-15/h3-10,18,21H,17H2,1-2H3 |
| InChIKey | FNGLMGREOBBCCW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|