C18H19NO — CID 15834051
2-(4-methoxyphenyl)-2,4-dimethyl-1H-quinoline (PubChem CID 15834051) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2,4-dimethyl-1H-quinoline.
| Compound Name | 2-(4-methoxyphenyl)-2,4-dimethyl-1H-quinoline |
|---|---|
| PubChem CID | 15834051 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-2,4-dimethyl-1H-quinoline |
| SMILES | COc1ccc(C2(C)C=C(C)c3ccccc3N2)cc1 |
| InChI | InChI=1S/C18H19NO/c1-13-12-18(2,14-8-10-15(20-3)11-9-14)19-17-7-5-4-6-16(13)17/h4-12,19H,1-3H3 |
| InChIKey | CTVWFBFLBRNPHQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_C(1)', 'substructure': 'N/A'} |
|---|