C25H20F3NO5S — CID 11397974
N-[3-(1-hydroxyethyl)phenyl]-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide (PubChem CID 11397974) has the molecular formula C25H20F3NO5S and a molecular weight of 503.50 g/mol. Its IUPAC name is N-[3-(1-hydroxyethyl)phenyl]-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide.
| Compound Name | N-[3-(1-hydroxyethyl)phenyl]-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11397974 |
| Molecular Formula | C25H20F3NO5S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | N-[3-(1-hydroxyethyl)phenyl]-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
| SMILES | CC(O)c1cccc(NS(=O)(=O)c2ccc(Cc3ccc4oc(=O)cc(C(F)(F)F)c4c3)cc2)c1 |
| InChI | InChI=1S/C25H20F3NO5S/c1-15(30)18-3-2-4-19(13-18)29-35(32,33)20-8-5-16(6-9-20)11-17-7-10-23-21(12-17)22(25(26,27)28)14-24(31)34-23/h2-10,12-15,29-30H,11H2,1H3 |
| InChIKey | FXFWNPZORNVEHT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|