C34H30F2N2O4S — CID 162580207
N-[[3-(benzylamino)phenyl]methyl]-4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxochromen-6-yl]methyl]benzenesulfonamide (PubChem CID 162580207) has the molecular formula C34H30F2N2O4S and a molecular weight of 600.69 g/mol. Its IUPAC name is N-[[3-(benzylamino)phenyl]methyl]-4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxochromen-6-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-(benzylamino)phenyl]methyl]-4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxochromen-6-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162580207 |
| Molecular Formula | C34H30F2N2O4S |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | N-[[3-(benzylamino)phenyl]methyl]-4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxochromen-6-yl]methyl]benzenesulfonamide |
| SMILES | C/C=C/C(F)(F)c1cc(=O)oc2ccc(Cc3ccc(S(=O)(=O)NCc4cccc(NCc5ccccc5)c4)cc3)cc12 |
| InChI | InChI=1S/C34H30F2N2O4S/c1-2-17-34(35,36)31-21-33(39)42-32-16-13-26(20-30(31)32)18-24-11-14-29(15-12-24)43(40,41)38-23-27-9-6-10-28(19-27)37-22-25-7-4-3-5-8-25/h2-17,19-21,37-38H,18,22-23H2,1H3/b17-2+ |
| InChIKey | DSXVSZWIMSNGOP-LAZPYJJCSA-N |
| XLogP | 7.14 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|