C27H25F2NO4S — CID 142967304
4-[[4-(1,1-difluoropropyl)-2-oxochromen-6-yl]methyl]-N-[(3-methylphenyl)methyl]benzenesulfonamide (PubChem CID 142967304) has the molecular formula C27H25F2NO4S and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-[[4-(1,1-difluoropropyl)-2-oxochromen-6-yl]methyl]-N-[(3-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-[[4-(1,1-difluoropropyl)-2-oxochromen-6-yl]methyl]-N-[(3-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142967304 |
| Molecular Formula | C27H25F2NO4S |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4-[[4-(1,1-difluoropropyl)-2-oxochromen-6-yl]methyl]-N-[(3-methylphenyl)methyl]benzenesulfonamide |
| SMILES | CCC(F)(F)c1cc(=O)oc2ccc(Cc3ccc(S(=O)(=O)NCc4cccc(C)c4)cc3)cc12 |
| InChI | InChI=1S/C27H25F2NO4S/c1-3-27(28,29)24-16-26(31)34-25-12-9-20(15-23(24)25)14-19-7-10-22(11-8-19)35(32,33)30-17-21-6-4-5-18(2)13-21/h4-13,15-16,30H,3,14,17H2,1-2H3 |
| InChIKey | TVLUXBYNICKBFQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|