C24H18F3NO5S — CID 11213977
N-(2-methoxyphenyl)-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide (PubChem CID 11213977) has the molecular formula C24H18F3NO5S and a molecular weight of 489.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11213977 |
| Molecular Formula | C24H18F3NO5S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(Cc2ccc3oc(=O)cc(C(F)(F)F)c3c2)cc1 |
| InChI | InChI=1S/C24H18F3NO5S/c1-32-22-5-3-2-4-20(22)28-34(30,31)17-9-6-15(7-10-17)12-16-8-11-21-18(13-16)19(24(25,26)27)14-23(29)33-21/h2-11,13-14,28H,12H2,1H3 |
| InChIKey | YUGVBTUBFYCTMU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|