C32H50O7 — CID 11398690
methyl (2Z,4E,7S,8E,10Z)-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-(2-methoxypropan-2-yloxy)dodeca-2,4,8,10-tetraenoate (PubChem CID 11398690) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is methyl (2Z,4E,7S,8E,10Z)-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-(2-methoxypropan-2-yloxy)dodeca-2,4,8,10-tetraenoate.
| Compound Name | methyl (2Z,4E,7S,8E,10Z)-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-(2-methoxypropan-2-yloxy)dodeca-2,4,8,10-tetraenoate |
|---|---|
| PubChem CID | 11398690 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | methyl (2Z,4E,7S,8E,10Z)-12-[(4S,6R)-6-[(1E,3E,8R)-8-hydroxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-(2-methoxypropan-2-yloxy)dodeca-2,4,8,10-tetraenoate |
| SMILES | COC(=O)/C=C\C=C\C[C@@H](/C=C/C=C\C[C@H]1C[C@H](/C=C/C=C/CCC[C@@H](C)O)OC(C)(C)O1)OC(C)(C)OC |
| InChI | InChI=1S/C32H50O7/c1-26(33)19-13-9-8-10-14-22-28-25-29(39-32(4,5)38-28)23-17-11-15-20-27(37-31(2,3)36-7)21-16-12-18-24-30(34)35-6/h8,10-12,14-18,20,22,24,26-29,33H,9,13,19,21,23,25H2,1-7H3/b10-8+,16-12+,17-11-,20-15+,22-14+,24-18-/t26-,27-,28+,29+/m1/s1 |
| InChIKey | XDWRZFXSOQULSX-IWQVXJODSA-N |
| XLogP | 6.51 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|