C15H22ClN3 — CID 114004330
2-(chloromethyl)-3-(2-ethylhexyl)imidazo[4,5-b]pyridine (PubChem CID 114004330) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(2-ethylhexyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-3-(2-ethylhexyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 114004330 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(chloromethyl)-3-(2-ethylhexyl)imidazo[4,5-b]pyridine |
| SMILES | CCCCC(CC)Cn1c(CCl)nc2cccnc21 |
| InChI | InChI=1S/C15H22ClN3/c1-3-5-7-12(4-2)11-19-14(10-16)18-13-8-6-9-17-15(13)19/h6,8-9,12H,3-5,7,10-11H2,1-2H3 |
| InChIKey | YVPKHCKKRSVRCQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|