About potassium butan-2-one
potassium butan-2-one (PubChem CID 11400740) has the molecular formula C4H7KO
and a molecular weight of 110.20 g/mol. Its IUPAC name is potassium butan-2-one.
Molecular Properties
| Compound Name | potassium butan-2-one |
| PubChem CID | 11400740 |
| Molecular Formula | C4H7KO |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | potassium butan-2-one |
| SMILES | [CH2-]C(=O)CC.[K+] |
| InChI | InChI=1S/C4H7O.K/c1-3-4(2)5;/h2-3H2,1H3;/q-1;+1 |
| InChIKey | UKSVAHYTHLOIQN-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium butan-2-one?
The IUPAC name of potassium butan-2-one (CID 11400740) is potassium butan-2-one.
What is the SMILES notation for potassium butan-2-one?
The canonical SMILES for potassium butan-2-one is [CH2-]C(=O)CC.[K+].
What is the InChIKey of potassium butan-2-one?
The InChIKey is UKSVAHYTHLOIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O.K/c1-3-4(2)5;/h2-3H2,1H3;/q-1;+1.
What are the key properties of potassium butan-2-one?
potassium butan-2-one has a molecular weight of 110.20 g/mol, XLogP of -2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium butan-2-one is sourced from PubChem (CID 11400740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).