C11H10F2N2O3S — CID 114036622
3-[(2,3-difluoropyridine-4-carbonyl)amino]thiolane-3-carboxylic acid (PubChem CID 114036622) has the molecular formula C11H10F2N2O3S and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-[(2,3-difluoropyridine-4-carbonyl)amino]thiolane-3-carboxylic acid.
| Compound Name | 3-[(2,3-difluoropyridine-4-carbonyl)amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114036622 |
| Molecular Formula | C11H10F2N2O3S |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-[(2,3-difluoropyridine-4-carbonyl)amino]thiolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCSC1)c1ccnc(F)c1F |
| InChI | InChI=1S/C11H10F2N2O3S/c12-7-6(1-3-14-8(7)13)9(16)15-11(10(17)18)2-4-19-5-11/h1,3H,2,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | SCTCDHIGZIXNKB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|