C18H21NO3 — CID 11403808
4-[2-(2,3-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 11403808) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[2-(2,3-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-[2-(2,3-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 11403808 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[2-(2,3-dimethoxyphenyl)ethyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | COc1cccc(CCN2CCOc3ccccc32)c1OC |
| InChI | InChI=1S/C18H21NO3/c1-20-17-9-5-6-14(18(17)21-2)10-11-19-12-13-22-16-8-4-3-7-15(16)19/h3-9H,10-13H2,1-2H3 |
| InChIKey | HFDVZTRBHDLNAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |